EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6BFO2 |
| Net Charge | 0 |
| Average Mass | 151.933 |
| Monoisotopic Mass | 152.04449 |
| SMILES | OB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C7H6BFO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4H2 |
| InChIKey | LFQDNHWZDQTITF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 6.1.1.4 (leucine--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that inhibits the action of leucine—tRNA synthetase (EC 6.1.1.4). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tavaborole (CHEBI:77942) has role antifungal agent (CHEBI:35718) |
| tavaborole (CHEBI:77942) has role EC 6.1.1.4 (leucine—tRNA ligase) inhibitor (CHEBI:77953) |
| tavaborole (CHEBI:77942) has role protein synthesis inhibitor (CHEBI:48001) |
| tavaborole (CHEBI:77942) is a benzoxaborole (CHEBI:78240) |
| tavaborole (CHEBI:77942) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5-fluoro-2,1-benzoxaborol-1(3H)-ol |
| Synonyms | Source |
|---|---|
| 5-Fluoro-1,3-dihydro-1-hydroxy-2,1-benzoxaborole | ChemIDplus |
| AN 2690 | ChemIDplus |
| AN-2690 | ChemIDplus |
| AN2690 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10657796 | Reaxys |
| CAS:174671-46-6 | KEGG DRUG |
| CAS:174671-46-6 | ChemIDplus |
| Citations |
|---|