EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6BFO2 |
| Net Charge | 0 |
| Average Mass | 151.933 |
| Monoisotopic Mass | 152.04449 |
| SMILES | OB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C7H6BFO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4H2 |
| InChIKey | LFQDNHWZDQTITF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 6.1.1.4 (leucine--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that inhibits the action of leucine—tRNA synthetase (EC 6.1.1.4). protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tavaborole (CHEBI:77942) has role antifungal agent (CHEBI:35718) |
| tavaborole (CHEBI:77942) has role EC 6.1.1.4 (leucine—tRNA ligase) inhibitor (CHEBI:77953) |
| tavaborole (CHEBI:77942) has role protein synthesis inhibitor (CHEBI:48001) |
| tavaborole (CHEBI:77942) is a benzoxaborole (CHEBI:78240) |
| tavaborole (CHEBI:77942) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5-fluoro-2,1-benzoxaborol-1(3H)-ol |
| Synonyms | Source |
|---|---|
| 5-Fluoro-1,3-dihydro-1-hydroxy-2,1-benzoxaborole | ChemIDplus |
| AN 2690 | ChemIDplus |
| AN-2690 | ChemIDplus |
| AN2690 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10657796 | Reaxys |
| CAS:174671-46-6 | KEGG DRUG |
| CAS:174671-46-6 | ChemIDplus |
| Citations |
|---|