EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H84O14 |
| Net Charge | 0 |
| Average Mass | 885.186 |
| Monoisotopic Mass | 884.58611 |
| SMILES | [H][C@]1([C@@H](C)C(=O)O)O[C@@H](C[C@@H](O)[C@H](C)[C@@]2([H])CC[C@H](C)[C@@](O)(C[C@H]3O[C@@](O)([C@H](O)[C@]4([H])CC[C@@](C)([C@]5(O)O[C@](C)([C@@]6([H])CC[C@@](C)(O)[C@H](CC)O6)C[C@H]5C)O4)[C@H](C)C[C@@H]3C)O2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C48H84O14/c1-13-38-43(10,53)18-17-39(58-38)44(11)23-30(7)48(56,62-44)45(12)19-16-35(59-45)41(50)47(55)29(6)21-26(3)37(61-47)24-46(54)28(5)14-15-34(60-46)31(8)33(49)22-36-25(2)20-27(4)40(57-36)32(9)42(51)52/h25-41,49-50,53-56H,13-24H2,1-12H3,(H,51,52)/t25-,26+,27+,28+,29-,30-,31+,32-,33-,34-,35+,36+,37-,38+,39-,40+,41-,43-,44+,45+,46-,47-,48-/m1/s1 |
| InChIKey | WWDHGOLBPBWCNJ-GXXSWWTOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alborixin (CHEBI:77940) has role ionophore (CHEBI:24869) |
| alborixin (CHEBI:77940) is a cyclic hemiketal (CHEBI:59780) |
| alborixin (CHEBI:77940) is a monocarboxylic acid (CHEBI:25384) |
| alborixin (CHEBI:77940) is a oxolanes (CHEBI:26912) |
| alborixin (CHEBI:77940) is a polyether antibiotic (CHEBI:26179) |
| IUPAC Name |
|---|
| (2R)-2-[(2S,3S,5R,6S)-6-{(2R,3S)-3-[(2R,5S,6R)-6-({(2R,3S,5R,6R)-6-[(R)-{(2S,2'R,3'R,5S,5'S)-5'-[(2R,5R,6S)-6-ethyl-5-hydroxy-5-methyltetrahydro-2H-pyran-2-yl]-2'-hydroxy-2,3',5'-trimethyloctahydro-2,2'-bifuran-5-yl}(hydroxy)methyl]-6-hydroxy-3,5-dimethyltetrahydro-2H-pyran-2-yl}methyl)-6-hydroxy-5-methyltetrahydro-2H-pyran-2-yl]-2-hydroxybutyl}-3,5-dimethyltetrahydro-2H-pyran-2-yl]propanoic acid |
| Synonym | Source |
|---|---|
| Antibiotic S 14750A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US4933364 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6262683 | Reaxys |
| CAS:57760-36-8 | ChemIDplus |
| Citations |
|---|