EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3N2O3 |
| Net Charge | -1 |
| Average Mass | 127.079 |
| Monoisotopic Mass | 127.01492 |
| SMILES | O=c1[c-]c(=O)nc(=O)n1 |
| InChI | InChI=1S/C4H3N2O3/c7-2-1-3(8)6-4(9)5-2/h1H,(H2,5,6,7,8,9)/q-1 |
| InChIKey | GVLZYMDNTPNTLV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barbiturate(1−) (CHEBI:77938) is a organic anion (CHEBI:25696) |
| barbiturate(1−) (CHEBI:77938) is conjugate base of barbituric acid (CHEBI:16294) |
| Incoming Relation(s) |
| barbituric acid (CHEBI:16294) is conjugate acid of barbiturate(1−) (CHEBI:77938) |
| IUPAC Name |
|---|
| 2,4,6-trioxohexahydropyrimidin-5-ide |
| UniProt Name | Source |
|---|---|
| barbiturate | UniProt |