EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19O11 |
| Net Charge | -1 |
| Average Mass | 447.372 |
| Monoisotopic Mass | 447.09329 |
| SMILES | [O-]c1cc([O-])c2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c(-c3ccc(O)c(O)c3)[o+]c2c1 |
| InChI | InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p-1/t16-,17+,18+,19-,21-/m1/s1 |
| InChIKey | RKWHWFONKJEUEF-WVXKDWSHSA-M |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanidin 3-O-β-D-galactoside(1−) (CHEBI:77935) has role food component (CHEBI:78295) |
| cyanidin 3-O-β-D-galactoside(1−) (CHEBI:77935) has role plant metabolite (CHEBI:76924) |
| cyanidin 3-O-β-D-galactoside(1−) (CHEBI:77935) is a phenolate anion (CHEBI:50525) |
| cyanidin 3-O-β-D-galactoside(1−) (CHEBI:77935) is conjugate base of cyanidin 3-O-β-D-galactoside betaine (CHEBI:71515) |
| Incoming Relation(s) |
| cyanidin 3-O-β-D-galactoside betaine (CHEBI:71515) is conjugate acid of cyanidin 3-O-β-D-galactoside(1−) (CHEBI:77935) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3-(β-D-galactopyranosyloxy)chromenium-5,7-diolate |
| UniProt Name | Source |
|---|---|
| cyanidin 3-O-β-D-galactoside | UniProt |