EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77930 - undecan-2-ol
| Formula | C11H24O |
| Net Charge | 0 |
| Average Mass | 172.312 |
| Monoisotopic Mass | 172.18272 |
| SMILES | CCCCCCCCCC(C)O |
| InChI | InChI=1S/C11H24O/c1-3-4-5-6-7-8-9-10-11(2)12/h11-12H,3-10H2,1-2H3 |
| InChIKey | XMUJIPOFTAHSOK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) | |
| Starmerella bacillaris (ncbitaxon:1247836) | - | MetaboLights (MTBLS212) | |
| Vitis vinifera (ncbitaxon:29760) | - | MetaboLights (MTBLS212) | |
| Prunus dulcis (ncbitaxon:3755) | - | PubMed (19344182) | |
| Lobiopa insularis (ncbitaxon:1970893) | - | PubMed (28601940) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| undecan-2-ol (CHEBI:77930) has role animal metabolite (CHEBI:75767) |
| undecan-2-ol (CHEBI:77930) has role flavouring agent (CHEBI:35617) |
| undecan-2-ol (CHEBI:77930) has role pheromone (CHEBI:26013) |
| undecan-2-ol (CHEBI:77930) has role plant metabolite (CHEBI:76924) |
| undecan-2-ol (CHEBI:77930) has role volatile oil component (CHEBI:27311) |
| undecan-2-ol (CHEBI:77930) is a secondary alcohol (CHEBI:35681) |
| undecan-2-ol (CHEBI:77930) is a undecanol (CHEBI:195608) |
| IUPAC Name |
|---|
| undecan-2-ol |
| Synonyms | Source |
|---|---|
| 2-undecanol | SUBMITTER |
| methyl nonyl carbinol | SUBMITTER |
| 2-hendecanol | SUBMITTER |
| 2-hydroxyundecane | ChemIDplus |
| sec-undecyl alcohol | HMDB |
| α-methyldecanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030942 | HMDB |
| FDB002918 | FooDB |
| LMFA05000621 | LIPID MAPS |
| Citations |
|---|