EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CCCCCCCCC(C)=O |
| InChI | InChI=1S/C10H20O/c1-3-4-5-6-7-8-9-10(2)11/h3-9H2,1-2H3 |
| InChIKey | ZAJNGDIORYACQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decan-2-one (CHEBI:77929) has parent hydride decane (CHEBI:41808) |
| decan-2-one (CHEBI:77929) has role plant metabolite (CHEBI:76924) |
| decan-2-one (CHEBI:77929) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| decan-2-one |
| Synonyms | Source |
|---|---|
| Octyl methyl ketone | ChEBI |
| 2-Decanone | ChEBI |
| Methyl octyl ketone | ChEBI |
| Methyl n-octyl ketone | ChEBI |
| n-C8H17COCH3 | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031409 | HMDB |
| Citations |
|---|