EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O |
| Net Charge | 0 |
| Average Mass | 142.242 |
| Monoisotopic Mass | 142.13577 |
| SMILES | CCCCCCCC(C)=O |
| InChI | InChI=1S/C9H18O/c1-3-4-5-6-7-8-9(2)10/h3-8H2,1-2H3 |
| InChIKey | VKCYHJWLYTUGCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonan-2-one (CHEBI:77927) has parent hydride nonane (CHEBI:32892) |
| nonan-2-one (CHEBI:77927) has role plant metabolite (CHEBI:76924) |
| nonan-2-one (CHEBI:77927) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| nonan-2-one |
| Synonyms | Source |
|---|---|
| 2-nonanone | SUBMITTER |
| beta-Nonanone | HMDB |
| heptyl methyl ketone | SUBMITTER |
| Methyl heptyl ketone | ChemIDplus |
| Methyl n-heptyl ketone | NIST Chemistry WebBook |
| n-C7H15COCH3 | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| nonan-2-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031266 | HMDB |
| Citations |
|---|