EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H70O12 |
| Net Charge | 0 |
| Average Mass | 754.999 |
| Monoisotopic Mass | 754.48673 |
| SMILES | [H][C@]1([C@H](C)[C@@]2([H])O[C@@]3(CC[C@@](C)([C@@]4([H])CC[C@@](C)([C@]5([H])O[C@@]([H])([C@@]6([H])O[C@](C)(O)[C@H](C)C[C@@H]6C)C[C@@H]5C)O4)O3)C[C@H](O)[C@H]2C)O[C@@](O)([C@H](C)C(=O)O)[C@H](C)[C@@H](OC)[C@H]1C |
| InChI | InChI=1S/C41H70O12/c1-20-17-22(3)39(11,45)50-31(20)29-18-21(2)35(48-29)38(10)14-13-30(49-38)37(9)15-16-40(53-37)19-28(42)23(4)32(51-40)24(5)33-25(6)34(47-12)26(7)41(46,52-33)27(8)36(43)44/h20-35,42,45-46H,13-19H2,1-12H3,(H,43,44)/t20-,21-,22+,23+,24+,25-,26+,27+,28-,29+,30+,31-,32-,33+,34-,35+,37-,38-,39-,40+,41+/m0/s1 |
| InChIKey | WWEDNBWYGGJQOV-RIWLGXEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mutalomycin (CHEBI:77918) has role bacterial metabolite (CHEBI:76969) |
| mutalomycin (CHEBI:77918) has role ionophore (CHEBI:24869) |
| mutalomycin (CHEBI:77918) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| mutalomycin (CHEBI:77918) is a cyclic hemiketal (CHEBI:59780) |
| mutalomycin (CHEBI:77918) is a oxolanes (CHEBI:26912) |
| mutalomycin (CHEBI:77918) is a polyether antibiotic (CHEBI:26179) |
| mutalomycin (CHEBI:77918) is a spiroketal (CHEBI:72600) |
| mutalomycin (CHEBI:77918) is conjugate acid of mutalomycin(1−) (CHEBI:77917) |
| Incoming Relation(s) |
| mutalomycin(1−) (CHEBI:77917) is conjugate base of mutalomycin (CHEBI:77918) |
| IUPAC Name |
|---|
| (5S)-1-C-[(1S)-1-carboxyethyl]-2,4-dideoxy-5-{(1S)-1-[(2S,5R,7S,8R,9S)-9-hydroxy-2-{(2S,2'R,3'S,5R,5'R)-5'-[(2S,3S,5R,6S)-6-hydroxy-3,5,6-trimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]ethyl}-2,4-dimethyl-3-O-methyl-β-L-arabinopyranose |
| Synonym | Source |
|---|---|
| antibiotic S 11743A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US4933364 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1614502 | Reaxys |
| CAS:62618-08-0 | ChemIDplus |
| Citations |
|---|