EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H69O12.Na |
| Net Charge | 0 |
| Average Mass | 776.981 |
| Monoisotopic Mass | 776.46867 |
| SMILES | [H][C@]1([C@H](C)[C@@]2([H])O[C@@]3(CC[C@@](C)([C@@]4([H])CC[C@@](C)([C@]5([H])O[C@@]([H])([C@@]6([H])O[C@](C)(O)[C@H](C)C[C@@H]6C)C[C@@H]5C)O4)O3)C[C@H](O)[C@H]2C)O[C@@](O)([C@H](C)C(=O)[O-])[C@H](C)[C@@H](OC)[C@H]1C.[Na+] |
| InChI | InChI=1S/C41H70O12.Na/c1-20-17-22(3)39(11,45)50-31(20)29-18-21(2)35(48-29)38(10)14-13-30(49-38)37(9)15-16-40(53-37)19-28(42)23(4)32(51-40)24(5)33-25(6)34(47-12)26(7)41(46,52-33)27(8)36(43)44;/h20-35,42,45-46H,13-19H2,1-12H3,(H,43,44);/q;+1/p-1/t20-,21-,22+,23+,24+,25-,26+,27+,28-,29+,30+,31-,32-,33+,34-,35+,37-,38-,39-,40+,41+;/m0./s1 |
| InChIKey | CPFAJMOABNHQTP-ZPZSSQNXSA-M |
| Roles Classification |
|---|
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mutalomycin sodium salt (CHEBI:77912) has part mutalomycin(1−) (CHEBI:77917) |
| mutalomycin sodium salt (CHEBI:77912) has role antimicrobial agent (CHEBI:33281) |
| mutalomycin sodium salt (CHEBI:77912) has role ionophore (CHEBI:24869) |
| mutalomycin sodium salt (CHEBI:77912) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (5S)-1-C-[(1S)-1-carboxylatoethyl]-2,4-dideoxy-5-{(1S)-1-[(2S,5R,7S,8R,9S)-9-hydroxy-2-{(2S,2'R,3'S,5R,5'R)-5'-[(2S,3S,5R,6S)-6-hydroxy-3,5,6-trimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]ethyl}-2,4-dimethyl-3-O-methyl-β-L-arabinopyranose |
| Synonyms | Source |
|---|---|
| 11-O-Demethyl-23,27-didemethoxylonomycin A sodium | ChemIDplus |
| Antibiotic S 11743A sodium salt | ChemIDplus |
| mutalomycin monosodium salt | IUBMB |
| Mutalomycin sodium | ChemIDplus |
| S 11743A sodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6265169 | Reaxys |
| CAS:62696-99-5 | ChemIDplus |
| Citations |
|---|