EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H88O18 |
| Net Charge | 0 |
| Average Mass | 1025.280 |
| Monoisotopic Mass | 1024.59707 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O[C@H]3C[C@H](O)[C@H](O)[C@H](C)O3)[C@H](CC)[C@@H](C)O2)OC(=O)/C=C/C=C/[C@H](C)[C@@]([H])([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O[C@H]3C[C@H](O)[C@H](O)[C@H](C)O3)[C@H](CC)[C@@H](C)O2)OC(=O)/C=C/C=C/[C@@H]1C |
| InChI | InChI=1S/C54H88O18/c1-13-37-33(9)71-53(63,25-41(37)67-45-23-39(55)49(61)35(11)65-45)31(7)47(59)29(5)51-27(3)19-15-17-22-44(58)70-52(28(4)20-16-18-21-43(57)69-51)30(6)48(60)32(8)54(64)26-42(38(14-2)34(10)72-54)68-46-24-40(56)50(62)36(12)66-46/h15-22,27-42,45-52,55-56,59-64H,13-14,23-26H2,1-12H3/b19-15+,20-16+,21-18+,22-17+/t27-,28-,29-,30-,31-,32-,33+,34+,35-,36-,37+,38+,39-,40-,41+,42+,45-,46-,47+,48+,49+,50+,51-,52-,53+,54+/m0/s1 |
| InChIKey | OSERMIPXNLXAPD-MJMYBOKFSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaiophylin (CHEBI:77879) has role antifungal agent (CHEBI:35718) |
| elaiophylin (CHEBI:77879) has role autophagy inhibitor (CHEBI:88230) |
| elaiophylin (CHEBI:77879) has role bacterial metabolite (CHEBI:76969) |
| elaiophylin (CHEBI:77879) is a lactol (CHEBI:38131) |
| elaiophylin (CHEBI:77879) is a macrodiolide (CHEBI:145556) |
| elaiophylin (CHEBI:77879) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (3E,5E,7S,8S,11E,13E,15S,16S)-8,16-bis{(2S,3R,4S)-4-[(2R,4R,5R,6R)-4-{[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-5-ethyl-2-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]-3-hydroxypentan-2-yl}-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| Synonyms | Source |
|---|---|
| Antibiotic 5001B | ChemIDplus |
| Antibiotic 56-62 | ChemIDplus |
| Azalomycin B | ChemIDplus |
| gopalamicin | ChEBI |
| salbomycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15844 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4227388 | Reaxys |
| CAS:37318-06-2 | ChemIDplus |
| Citations |
|---|