EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H88O18 |
| Net Charge | 0 |
| Average Mass | 1025.280 |
| Monoisotopic Mass | 1024.59707 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O[C@H]3C[C@H](O)[C@H](O)[C@H](C)O3)[C@H](CC)[C@@H](C)O2)OC(=O)/C=C/C=C/[C@H](C)[C@@]([H])([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O[C@H]3C[C@H](O)[C@H](O)[C@H](C)O3)[C@H](CC)[C@@H](C)O2)OC(=O)/C=C/C=C/[C@@H]1C |
| InChI | InChI=1S/C54H88O18/c1-13-37-33(9)71-53(63,25-41(37)67-45-23-39(55)49(61)35(11)65-45)31(7)47(59)29(5)51-27(3)19-15-17-22-44(58)70-52(28(4)20-16-18-21-43(57)69-51)30(6)48(60)32(8)54(64)26-42(38(14-2)34(10)72-54)68-46-24-40(56)50(62)36(12)66-46/h15-22,27-42,45-52,55-56,59-64H,13-14,23-26H2,1-12H3/b19-15+,20-16+,21-18+,22-17+/t27-,28-,29-,30-,31-,32-,33+,34+,35-,36-,37+,38+,39-,40-,41+,42+,45-,46-,47+,48+,49+,50+,51-,52-,53+,54+/m0/s1 |
| InChIKey | OSERMIPXNLXAPD-MJMYBOKFSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaiophylin (CHEBI:77879) has role antifungal agent (CHEBI:35718) |
| elaiophylin (CHEBI:77879) has role autophagy inhibitor (CHEBI:88230) |
| elaiophylin (CHEBI:77879) has role bacterial metabolite (CHEBI:76969) |
| elaiophylin (CHEBI:77879) is a lactol (CHEBI:38131) |
| elaiophylin (CHEBI:77879) is a macrodiolide (CHEBI:145556) |
| elaiophylin (CHEBI:77879) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (3E,5E,7S,8S,11E,13E,15S,16S)-8,16-bis{(2S,3R,4S)-4-[(2R,4R,5R,6R)-4-{[(2R,4S,5S,6S)-4,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-5-ethyl-2-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]-3-hydroxypentan-2-yl}-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| Synonyms | Source |
|---|---|
| Antibiotic 5001B | ChemIDplus |
| Antibiotic 56-62 | ChemIDplus |
| Azalomycin B | ChemIDplus |
| gopalamicin | ChEBI |
| salbomycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15844 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4227388 | Reaxys |
| CAS:37318-06-2 | ChemIDplus |
| Citations |
|---|