EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H64FeN9O17 |
| Net Charge | 0 |
| Average Mass | 1010.854 |
| Monoisotopic Mass | 1010.37695 |
| SMILES | C/C(=C/C1=[O+][Fe-3]2345[O]N1CCC[C@@H]1NC(=O)[C@H](CCCN([O]2)C(/C=C(/C)CCO)=[O+]3)NC(=O)[C@H](CCCN([O]4)C(/C=C(/C)CCO)=[O+]5)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)CNC1=O)CCO |
| InChI | InChI=1S/C41H64N9O17.Fe/c1-25(10-16-51)19-34(57)48(65)13-4-7-28-37(60)42-22-33(56)43-31(23-54)40(63)47-32(24-55)41(64)46-30(9-6-15-50(67)36(59)21-27(3)12-18-53)39(62)45-29(38(61)44-28)8-5-14-49(66)35(58)20-26(2)11-17-52;/h19-21,28-32,51-55H,4-18,22-24H2,1-3H3,(H,42,60)(H,43,56)(H,44,61)(H,45,62)(H,46,64)(H,47,63);/q-3;+3/b25-19-,26-20-,27-21-;/t28-,29-,30-,31-,32-;/m0./s1 |
| InChIKey | SEQVPEQKJMMKNO-RQCMKQRDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrirubin (CHEBI:77867) has role fungal metabolite (CHEBI:76946) |
| ferrirubin (CHEBI:77867) is a ferrichromes (CHEBI:61414) |
| ferrirubin (CHEBI:77867) is a homoallylic alcohol (CHEBI:134362) |
| IUPAC Name |
|---|
| (cyclo{glycyl-L-seryl-L-seryl-N5-(hydroxy-κO)-N5-[(2Z)-5-hydroxy-3-methyl-1-(oxo-κO)pent-2-en-1-yl]-L-ornithyl-N5-(hydroxy-κO)-N5-[(2Z)-5-hydroxy-3-methyl-1-(oxo-κO)pent-2-en-1-yl]-L-ornithyl-N5-hydroxy-κO-N5-[(2Z)-5-hydroxy-3-methyl-1-(oxo-κO)pent-2-en-1-yl]-L-ornithyl})iron |
| Synonym | Source |
|---|---|
| Ferrirhodin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:29825-06-7 | ChemIDplus |
| Citations |
|---|