EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O2 |
| Net Charge | 0 |
| Average Mass | 114.104 |
| Monoisotopic Mass | 114.04293 |
| SMILES | N#CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H6N2O2/c5-2-1-3(6)4(7)8/h3H,1,6H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | BXRLWGXPSRYJDZ-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-cyano-L-alanine zwitterion (CHEBI:77860) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 3-cyano-L-alanine zwitterion (CHEBI:77860) is conjugate acid of 3-cyano-L-alaninate (CHEBI:57954) |
| 3-cyano-L-alanine zwitterion (CHEBI:77860) is tautomer of 3-cyano-L-alanine (CHEBI:16934) |
| Incoming Relation(s) |
| 3-cyano-L-alaninate (CHEBI:57954) is conjugate base of 3-cyano-L-alanine zwitterion (CHEBI:77860) |
| 3-cyano-L-alanine (CHEBI:16934) is tautomer of 3-cyano-L-alanine zwitterion (CHEBI:77860) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-cyanopropanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-3-cyanopropanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| 3-cyano-L-alanine | UniProt |