EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5O3 |
| Net Charge | -1 |
| Average Mass | 161.136 |
| Monoisotopic Mass | 161.02442 |
| SMILES | O=c1cc([O-])c2ccccc2o1 |
| InChI | InChI=1S/C9H6O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,10H/p-1 |
| InChIKey | VXIXUWQIVKSKSA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycoumarin(1−) (CHEBI:77858) is a organic anion (CHEBI:25696) |
| 4-hydroxycoumarin(1−) (CHEBI:77858) is conjugate base of 4-hydroxycoumarin (CHEBI:40070) |
| Incoming Relation(s) |
| 4-hydroxycoumarin (CHEBI:40070) is conjugate acid of 4-hydroxycoumarin(1−) (CHEBI:77858) |
| IUPAC Name |
|---|
| 2-oxo-2H-chromen-4-olate |
| Synonym | Source |
|---|---|
| 4-oxidocoumarin(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-hydroxycoumarin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12111 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4418505 | Reaxys |