EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5ClO3 |
| Net Charge | 0 |
| Average Mass | 124.523 |
| Monoisotopic Mass | 123.99272 |
| SMILES | O=C(O)C(O)CCl |
| InChI | InChI=1S/C3H5ClO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7) |
| InChIKey | OSLCJYYQMKPZHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chlorolactic acid (CHEBI:77855) has functional parent rac-lactic acid (CHEBI:28358) |
| 3-chlorolactic acid (CHEBI:77855) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 3-chlorolactic acid (CHEBI:77855) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 3-chloro-2-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Chloro-2-hydroxypropionic acid | ChEBI |
| beta-Chlorolactic acid | ChEBI |
| β-chlorolactic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:635947 | Reaxys |
| CAS:1713-85-5 | ChemIDplus |