EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H47NO |
| Net Charge | 0 |
| Average Mass | 401.679 |
| Monoisotopic Mass | 401.36577 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)C)[C@]1([H])C(N)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H47NO/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(29)15-19(26)16-24(25)28/h16-18,20-25,29H,6-15,28H2,1-5H3/t18-,20+,21-,22+,23+,24?,25+,26+,27-/m1/s1 |
| InChIKey | WLHQSAYHIOPMMJ-UOQFGJKXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-aminocholesterol (CHEBI:77845) has functional parent cholesterol (CHEBI:16113) |
| 7-aminocholesterol (CHEBI:77845) has role antibacterial agent (CHEBI:33282) |
| 7-aminocholesterol (CHEBI:77845) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7-aminocholesterol (CHEBI:77845) is a 3β-sterol (CHEBI:35348) |
| 7-aminocholesterol (CHEBI:77845) is a cholestanoid (CHEBI:50401) |
| 7-aminocholesterol (CHEBI:77845) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 7-aminocholest-5-en-3β-ol |
| Synonym | Source |
|---|---|
| (3beta)-7-Aminocholest-5-en-3-ol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9165538 | Reaxys |
| CAS:156856-03-0 | ChemIDplus |
| Citations |
|---|