EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11FN2O2 |
| Net Charge | 0 |
| Average Mass | 222.219 |
| Monoisotopic Mass | 222.08046 |
| SMILES | NC(Cc1cnc2ccc(F)cc12)C(=O)O |
| InChI | InChI=1S/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | INPQIVHQSQUEAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluorotryptophan (CHEBI:77837) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 5-fluorotryptophan (CHEBI:77837) is a organofluorine compound (CHEBI:37143) |
| 5-fluorotryptophan (CHEBI:77837) is a tryptophan derivative (CHEBI:27164) |
| IUPAC Name |
|---|
| 5-fluorotryptophan |
| Synonyms | Source |
|---|---|
| 2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid | IUPAC |
| 5-fluoro-DL-tryptophan | ChEBI |
| DL-5-Fluorotryptophan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DL-5-FLUOROTRYPTOPHAN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22753 | Reaxys |
| CAS:154-08-5 | ChemIDplus |
| Citations |
|---|