EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO2 |
| Net Charge | 0 |
| Average Mass | 273.376 |
| Monoisotopic Mass | 273.17288 |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)CCC=C[C@@H]1N(C)C |
| InChI | InChI=1S/C17H23NO2/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3/h5-8,10-12,15H,4,9,13H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | WDEFBBTXULIOBB-DOTOQJQBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-dextilidine (CHEBI:77821) is a ethyl 2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate (CHEBI:77817) |
| ent-dextilidine (CHEBI:77821) is enantiomer of dextilidine (CHEBI:77822) |
| Incoming Relation(s) |
| tilidine (CHEBI:77823) has part ent-dextilidine (CHEBI:77821) |
| dextilidine (CHEBI:77822) is enantiomer of ent-dextilidine (CHEBI:77821) |
| IUPAC Name |
|---|
| ethyl (1R,2S)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate |
| Synonym | Source |
|---|---|
| (−)-ethyl trans-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate | ChEBI |