EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO2S |
| Net Charge | 0 |
| Average Mass | 171.221 |
| Monoisotopic Mass | 171.03540 |
| SMILES | N[C@H](Cc1cccs1)C(=O)O |
| InChI | InChI=1S/C7H9NO2S/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10)/t6-/m1/s1 |
| InChIKey | WTOFYLAWDLQMBZ-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-(2-thienyl)-D-alanine (CHEBI:77819) has functional parent D-alanine (CHEBI:15570) |
| β-(2-thienyl)-D-alanine (CHEBI:77819) is a D-α-amino acid (CHEBI:16733) |
| β-(2-thienyl)-D-alanine (CHEBI:77819) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 3-(2-thienyl)-D-alanine |
| Synonyms | Source |
|---|---|
| β-(2-thiophenyl)-D-alanine | ChEBI |
| 3-(2-thiophenyl)-D-alanine | ChEBI |
| (2R)-2-amino-3-(2-thienyl)propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82873 | Reaxys |