EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | [H][C@]12CCCc3c1n(c1ccc(C4CCCCC4)cc31)CCN2 |
| InChI | InChI=1S/C20H26N2/c1-2-5-14(6-3-1)15-9-10-19-17(13-15)16-7-4-8-18-20(16)22(19)12-11-21-18/h9-10,13-14,18,21H,1-8,11-12H2/t18-/m0/s1 |
| InChIKey | AUXCHYJDVJZEPG-SFHVURJKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-tetrindole (CHEBI:77815) is a 8-cyclohexyl-2,3,3a,4,5,6-hexahydropyrazino[3,2,1-jk]carbazole (CHEBI:77813) |
| (S)-tetrindole (CHEBI:77815) is conjugate base of (S)-tetrindole(1+) (CHEBI:77797) |
| (S)-tetrindole (CHEBI:77815) is enantiomer of (R)-tetrindole (CHEBI:77814) |
| Incoming Relation(s) |
| tetrindole (CHEBI:77799) has part (S)-tetrindole (CHEBI:77815) |
| (S)-tetrindole(1+) (CHEBI:77797) is conjugate acid of (S)-tetrindole (CHEBI:77815) |
| (R)-tetrindole (CHEBI:77814) is enantiomer of (S)-tetrindole (CHEBI:77815) |
| IUPAC Name |
|---|
| (3aS)-8-cyclohexyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole |
| Synonym | Source |
|---|---|
| (S)-(+)-tetrindole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7415487 | Reaxys |