EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O3 |
| Net Charge | 0 |
| Average Mass | 256.301 |
| Monoisotopic Mass | 256.10994 |
| SMILES | COc1cc2c(c(OC)c1)-c1ccc(O)cc1CC2 |
| InChI | InChI=1S/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3 |
| InChIKey | HOVUVTNDNLNINP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Orchinol (CHEBI:7779) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| 9,10-Dihydro-5,7-dimethoxyphenanthren-2-ol | KEGG COMPOUND |
| Orchinol | KEGG COMPOUND |