EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77780 - sulfaphenazole
| Formula | C15H14N4O2S |
| Net Charge | 0 |
| Average Mass | 314.370 |
| Monoisotopic Mass | 314.08375 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N4O2S/c16-12-6-8-14(9-7-12)22(20,21)18-15-10-11-17-19(15)13-4-2-1-3-5-13/h1-11,18H,16H2 |
| InChIKey | QWCJHSGMANYXCW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of quinine 3-monooxygenase (EC 1.14.13.67). antibacterial drug A drug used to treat or prevent bacterial infections. EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of 13-deoxydaunorubicin hydroxylase (EC 1.14.13.181). P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfaphenazole (CHEBI:77780) has role antibacterial drug (CHEBI:36047) |
| sulfaphenazole (CHEBI:77780) has role EC 1.14.13.181 (13-deoxydaunorubicin hydroxylase) inhibitor (CHEBI:77781) |
| sulfaphenazole (CHEBI:77780) has role EC 1.14.13.67 (quinine 3-monooxygenase) inhibitor (CHEBI:77783) |
| sulfaphenazole (CHEBI:77780) has role P450 inhibitor (CHEBI:50183) |
| sulfaphenazole (CHEBI:77780) is a primary amino compound (CHEBI:50994) |
| sulfaphenazole (CHEBI:77780) is a pyrazoles (CHEBI:26410) |
| sulfaphenazole (CHEBI:77780) is a substituted aniline (CHEBI:48975) |
| sulfaphenazole (CHEBI:77780) is a sulfonamide (CHEBI:35358) |
| sulfaphenazole (CHEBI:77780) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(1-phenyl-1H-pyrazol-5-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfafenazol | WHO MedNet |
| sulfaphenazole | WHO MedNet |
| sulfaphénazol | WHO MedNet |
| sulfaphenazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-phenyl-5-sulfanilamidopyrazole | NIST Chemistry WebBook |
| sulphaphenazole | KEGG DRUG |
| 5-sulfanilamido-1-phenylpyrazole | NIST Chemistry WebBook |
| 3-(p-aminobenzenesulfonamido)-2-phenylpyrazole | NIST Chemistry WebBook |
| N'-(1-phenylpyrazol-5-yl)sulfanilamide | NIST Chemistry WebBook |
| N1-(1-phenylpyrazol-5-yl)sulfanilamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sulfabid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01954 | KEGG DRUG |
| DB06729 | DrugBank |
| HMDB0015667 | HMDB |
| US2858309 | Patent |
| Sulfaphenazole | Wikipedia |
| LSM-5279 | LINCS |
| 2523 | DrugCentral |
| Citations |
|---|