EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16ClNOS |
| Net Charge | 0 |
| Average Mass | 257.786 |
| Monoisotopic Mass | 257.06411 |
| SMILES | CCN(CC)C(=O)SCc1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-7-5-6-8-11(10)13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | LLLFASISUZUJEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orbencarb (CHEBI:7778) has role environmental contaminant (CHEBI:78298) |
| orbencarb (CHEBI:7778) has role herbicide (CHEBI:24527) |
| orbencarb (CHEBI:7778) has role xenobiotic (CHEBI:35703) |
| orbencarb (CHEBI:7778) is a monochlorobenzenes (CHEBI:83403) |
| orbencarb (CHEBI:7778) is a monothiocarbamic ester (CHEBI:38128) |
| IUPAC Name |
|---|
| S-(2-chlorobenzyl) diethylcarbamothioate |
| Synonyms | Source |
|---|---|
| Diethylthiocarbamic acid S-(o-chlorobenzyl) ester | ChemIDplus |
| S-(2-Chlorobenzyl)-N,N-diethylthiolcarbamate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 493 | PPDB |
| C11087 | KEGG COMPOUND |
| orbencarb | Alan Wood's Pesticides |
| WO2004010784 | Patent |
| WO2009053095 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1968914 | Reaxys |
| CAS:34622-58-7 | KEGG COMPOUND |
| CAS:34622-58-7 | ChemIDplus |