EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10Cl2F3N3O3 |
| Net Charge | 0 |
| Average Mass | 432.185 |
| Monoisotopic Mass | 431.00513 |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C17H10Cl2F3N3O3/c1-28-12-4-2-9(8-3-5-13(17(20,21)22)23-14(8)12)16(26)24-15-10(18)6-25(27)7-11(15)19/h2-7H,1H3,(H,24,26) |
| InChIKey | RUOGJYKOQBFJIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SCH-351591 (CHEBI:77774) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| SCH-351591 (CHEBI:77774) is a aromatic amide (CHEBI:62733) |
| SCH-351591 (CHEBI:77774) is a aromatic ether (CHEBI:35618) |
| SCH-351591 (CHEBI:77774) is a chloropyridine (CHEBI:39173) |
| SCH-351591 (CHEBI:77774) is a monocarboxylic acid amide (CHEBI:29347) |
| SCH-351591 (CHEBI:77774) is a organofluorine compound (CHEBI:37143) |
| SCH-351591 (CHEBI:77774) is a pyridine N-oxides (CHEBI:38189) |
| SCH-351591 (CHEBI:77774) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| N-(3,5-dichloro-1-oxidopyridin-4-yl)-8-methoxy-2-(trifluoromethyl)quinoline-5-carboxamide |
| Synonyms | Source |
|---|---|
| 8-methoxy-2-trifluoromethylquinoline-5-carboxylic acid (3,5-dichloro-1-oxypyridin-4-yl)amide | ChEBI |
| N-(3,5-dichloro-1-oxido-4-pyridinyl)-8-methoxy-2-(trifluoromethyl)-5-quinoline carboxamide | ChemIDplus |
| Sch 351591 | ChemIDplus |
| Sch-351591 | ChemIDplus |
| SCH351591 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NZ528621 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9159062 | Reaxys |
| CAS:444659-43-2 | ChemIDplus |
| Citations |
|---|