EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO4 |
| Net Charge | 0 |
| Average Mass | 433.548 |
| Monoisotopic Mass | 433.22531 |
| SMILES | [H][C@]12CC[C@H](C)C[C@]1([H])[C@@H](/C=C/C)[C@H](C(=O)c1c(O)c(-c3ccc(O)cc3)cnc1=O)C=C2C |
| InChI | InChI=1S/C27H31NO4/c1-4-5-20-21-12-15(2)6-11-19(21)16(3)13-22(20)25(30)24-26(31)23(14-28-27(24)32)17-7-9-18(29)10-8-17/h4-5,7-10,13-15,19-22,29H,6,11-12H2,1-3H3,(H2,28,31,32)/b5-4+/t15-,19+,20+,21-,22+/m0/s1 |
| InChIKey | BYVVOONSAAQMKI-RFKCMYLBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilicicolin H (CHEBI:77772) has role antimicrobial agent (CHEBI:33281) |
| ilicicolin H (CHEBI:77772) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| ilicicolin H (CHEBI:77772) is a aromatic ketone (CHEBI:76224) |
| ilicicolin H (CHEBI:77772) is a carbobicyclic compound (CHEBI:36785) |
| ilicicolin H (CHEBI:77772) is a ilicicolin (CHEBI:146212) |
| ilicicolin H (CHEBI:77772) is a monohydroxypyridine (CHEBI:38182) |
| ilicicolin H (CHEBI:77772) is a octahydronaphthalenes (CHEBI:138397) |
| ilicicolin H (CHEBI:77772) is a phenols (CHEBI:33853) |
| ilicicolin H (CHEBI:77772) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| 3-[(2E,4E,8S,10E,12Z)-4,8-dimethyltetradeca-2,4,10,12-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1,2-dihydropyridin-2-one (CHEBI:155889) has functional parent ilicicolin H (CHEBI:77772) |
| IUPAC Name |
|---|
| 3-({(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(1E)-prop-1-en-1-yl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl}carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one |
| UniProt Name | Source |
|---|---|
| ilicicolin H | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101260418 | Patent |
| C00028381 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1631061 | Reaxys |
| Citations |
|---|