EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H60N2O7 |
| Net Charge | 0 |
| Average Mass | 692.938 |
| Monoisotopic Mass | 692.44005 |
| SMILES | [H][C@]1(/C(C)=C/C=C(\C)CNC(=O)[C@H](CO)NC=O)OC(=O)/C(C)=C/[C@H](C)/C=C/C(C)=C/[C@@H](OC)C/C=C/C(C)=C\CC[C@H](OC)/C=C/C=C/[C@@H]1C |
| InChI | InChI=1S/C41H60N2O7/c1-29-14-12-18-36(48-8)17-11-10-16-33(5)39(34(6)23-22-32(4)26-42-40(46)38(27-44)43-28-45)50-41(47)35(7)24-30(2)20-21-31(3)25-37(49-9)19-13-15-29/h10-11,13-17,20-25,28,30,33,36-39,44H,12,18-19,26-27H2,1-9H3,(H,42,46)(H,43,45)/b15-13+,16-10+,17-11+,21-20+,29-14-,31-25+,32-22+,34-23+,35-24+/t30-,33+,36-,37+,38+,39+/m1/s1 |
| InChIKey | YVOFDUHVTLZRBY-CLRFZDQZSA-N |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lejimalide B (CHEBI:77759) has functional parent L-serine (CHEBI:17115) |
| lejimalide B (CHEBI:77759) has role antineoplastic agent (CHEBI:35610) |
| lejimalide B (CHEBI:77759) has role marine metabolite (CHEBI:76507) |
| lejimalide B (CHEBI:77759) is a ether (CHEBI:25698) |
| lejimalide B (CHEBI:77759) is a formamides (CHEBI:24079) |
| lejimalide B (CHEBI:77759) is a macrolide (CHEBI:25106) |
| IUPAC Name |
|---|
| N-{(2E,4E)-5-[(2S,3S,4E,6E,8S,11Z,13E,16S,17E,19E,21R,22E)-8,16-dimethoxy-3,12,18,21,23-pentamethyl-24-oxooxacyclotetracosa-4,6,11,13,17,19,22-heptaen-2-yl]-2-methylhexa-2,4-dien-1-yl}-N2-formyl-L-serinamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9377649 | Reaxys |
| CAS:117582-92-0 | ChemIDplus |