EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H69N11O3 |
| Net Charge | 0 |
| Average Mass | 788.099 |
| Monoisotopic Mass | 787.55849 |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2nc(C(C)(C)C)c(C[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C43H69N11O3/c1-41(2,3)27-23-28-29(35(43(7,8)9)54-34(28)30(24-27)42(4,5)6)25-33(53-36(55)31(44)17-13-20-50-39(45)46)38(57)52-32(18-14-21-51-40(47)48)37(56)49-22-19-26-15-11-10-12-16-26/h10-12,15-16,23-24,31-33,54H,13-14,17-22,25,44H2,1-9H3,(H,49,56)(H,52,57)(H,53,55)(H4,45,46,50)(H4,47,48,51)/t31-,32-,33-/m0/s1 |
| InChIKey | ZVOYWSKEBVVLGW-ZDCRTTOTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | peptidomimetic A small protein-like chain designed to mimic a peptide. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LTX-109 (CHEBI:77752) has role antimicrobial agent (CHEBI:33281) |
| LTX-109 (CHEBI:77752) has role peptidomimetic (CHEBI:63175) |
| LTX-109 (CHEBI:77752) is a monocarboxylic acid amide (CHEBI:29347) |
| LTX-109 (CHEBI:77752) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-arginyl-2,5,7-tri-tert-butyl-L-tryptophyl-N-(2-phenylethyl)-L-argininamide |
| Manual Xrefs | Databases |
|---|---|
| US2011236453 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21795620 | Reaxys |
| CAS:1166254-80-3 | ChemIDplus |
| Citations |
|---|