EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | CO[C@H](C/C=C\C=C\CC/C=C/C[C@H](C)/C=C/C(=C\C(=O)O)CC(=O)O)/C(C)=C\C=C(/C)C(=O)O |
| InChI | InChI=1S/C28H38O7/c1-21(15-18-24(19-26(29)30)20-27(31)32)13-11-9-7-5-6-8-10-12-14-25(35-4)22(2)16-17-23(3)28(33)34/h6,8-12,15-19,21,25H,5,7,13-14,20H2,1-4H3,(H,29,30)(H,31,32)(H,33,34)/b8-6+,11-9+,12-10-,18-15+,22-16-,23-17+,24-19+/t21-,25+/m0/s1 |
| InChIKey | SHCXABJSXUACKU-WUTQZGRKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia gladioli (ncbitaxon:28095) | - | PubMed (28105575) | Species also known as Pseudomonas cocovenenans. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. ATP/ADP translocase inhibitor Any inhibitor of the trasporter protein ATP/ADP translocase. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.5.1.18 (glutathione transferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of a glutathione transferase (EC 2.5.1.18). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bongkrekic acid (CHEBI:77742) has role apoptosis inhibitor (CHEBI:68494) |
| bongkrekic acid (CHEBI:77742) has role ATP/ADP translocase inhibitor (CHEBI:77750) |
| bongkrekic acid (CHEBI:77742) has role bacterial metabolite (CHEBI:76969) |
| bongkrekic acid (CHEBI:77742) has role EC 2.5.1.18 (glutathione transferase) inhibitor (CHEBI:76797) |
| bongkrekic acid (CHEBI:77742) has role toxin (CHEBI:27026) |
| bongkrekic acid (CHEBI:77742) is a ether (CHEBI:25698) |
| bongkrekic acid (CHEBI:77742) is a olefinic compound (CHEBI:78840) |
| bongkrekic acid (CHEBI:77742) is a tricarboxylic acid (CHEBI:27093) |
| bongkrekic acid (CHEBI:77742) is conjugate acid of bongkrekate(3−) (CHEBI:178020) |
| Incoming Relation(s) |
| bongkrekate(3−) (CHEBI:178020) is conjugate base of bongkrekic acid (CHEBI:77742) |
| IUPAC Name |
|---|
| (2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-20-(carboxymethyl)-6-methoxy-2,5,17-trimethyldocosa-2,4,8,10,14,18,20-heptaenedioic acid |
| Synonyms | Source |
|---|---|
| (2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-20-(carboxymethyl)-6-methoxy-2,5,17-trimethyl-2,4,8,10,14,18,20-docosaheptaenedioic acid | ChEBI |
| bongkrek acid | PDBeChem |
| (−)-bongkrekic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4938689 | ChemSpider |
| BKC | PDBeChem |
| Bongkrek_acid | Wikipedia |
| JP2005068064 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1717902 | Reaxys |
| CAS:11076-19-0 | ChemIDplus |
| Citations |
|---|