EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H85NO14 |
| Net Charge | 0 |
| Average Mass | 912.212 |
| Monoisotopic Mass | 911.59701 |
| SMILES | [H][C@]12/C=C/CCCCC[C@@](C)(O)[C@H](O)[C@@H](O[C@H]3CC[C@H](N(C)C)[C@H](C)O3)[C@H](O)[C@@H](C)[C@H](O)[C@](C)(O)/C=C/C(=O)O[C@H]3C[C@@]4(CCC[C@H](C[C@H](O)CC)O4)O[C@@H](C[C@]1(O)OC(C)(C)C2)[C@H]3C |
| InChI | InChI=1S/C49H85NO14/c1-11-34(51)26-35-19-17-24-48(62-35)28-37-30(2)38(63-48)29-49(58)33(27-45(5,6)64-49)18-15-13-12-14-16-23-46(7,56)44(55)42(61-40-21-20-36(50(9)10)32(4)59-40)41(53)31(3)43(54)47(8,57)25-22-39(52)60-37/h15,18,22,25,30-38,40-44,51,53-58H,11-14,16-17,19-21,23-24,26-29H2,1-10H3/b18-15+,25-22+/t30-,31+,32-,33+,34+,35+,36-,37-,38-,40-,41+,42-,43-,44+,46+,47+,48+,49-/m0/s1 |
| InChIKey | XGECDDPXIKFBTE-AUFVQPSPSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ossamycin (CHEBI:77735) has role antineoplastic agent (CHEBI:35610) |
| ossamycin (CHEBI:77735) has role bacterial metabolite (CHEBI:76969) |
| ossamycin (CHEBI:77735) is a cyclic hemiketal (CHEBI:59780) |
| ossamycin (CHEBI:77735) is a macrolide antibiotic (CHEBI:25105) |
| ossamycin (CHEBI:77735) is a organic heterotetracyclic compound (CHEBI:38163) |
| ossamycin (CHEBI:77735) is a secondary alcohol (CHEBI:35681) |
| ossamycin (CHEBI:77735) is a spiroketal (CHEBI:72600) |
| ossamycin (CHEBI:77735) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3aS,4E,6'R,11R,12R,13S,14R,15R,16S,17R,18E,22S,24R,26S,27aS,28R)-13-{[(2S,5S,6S)-5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-11,12,14,16,17,27a-hexahydroxy-6'-[(2R)-2-hydroxybutyl]-2,2,11,15,17,28-hexamethyl-2,3,3',3a,4',5',6,6',7,8,9,10,11,12,13,14,15,16,17,22,23,26,27,27a-tetracosahydro-20H-spiro[22,26-methanofuro[2,3-h][1,5]dioxacyclohexacosine-24,2'-pyran]-20-one |
| Manual Xrefs | Databases |
|---|---|
| US3271253 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7510041 | Reaxys |
| CAS:11015-84-2 | ChemIDplus |
| Citations |
|---|