EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cd.2NO3 |
| Net Charge | 0 |
| Average Mass | 236.420 |
| Monoisotopic Mass | 237.87899 |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Cd+2] |
| InChI | InChI=1S/Cd.2NO3/c;2*2-1(3)4/q+2;2*-1 |
| InChIKey | XIEPJMXMMWZAAV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadmium nitrate (CHEBI:77732) has part cadmium(2+) (CHEBI:48775) |
| cadmium nitrate (CHEBI:77732) has role carcinogenic agent (CHEBI:50903) |
| cadmium nitrate (CHEBI:77732) has role genotoxin (CHEBI:50902) |
| cadmium nitrate (CHEBI:77732) has role hepatotoxic agent (CHEBI:50908) |
| cadmium nitrate (CHEBI:77732) is a cadmium salt (CHEBI:50293) |
| cadmium nitrate (CHEBI:77732) is a inorganic nitrate salt (CHEBI:51084) |
| Incoming Relation(s) |
| cadmium nitrate tetrahydrate (CHEBI:86156) has part cadmium nitrate (CHEBI:77732) |
| IUPAC Name |
|---|
| cadmium dinitrate |
| Synonyms | Source |
|---|---|
| Nitric acid, cadmium salt (2:1) | ChemIDplus |
| Nitric acid, cadmium salt | ChemIDplus |
| Cadmium(II) nitrate | ChemIDplus |
| Cd(NO3)2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Cadmium_nitrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8156730 | Reaxys |
| CAS:10325-94-7 | ChemIDplus |
| Citations |
|---|