EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N4O2S |
| Net Charge | 0 |
| Average Mass | 454.640 |
| Monoisotopic Mass | 454.24025 |
| SMILES | CN(C)CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H34N4O2S/c1-25(2,3)19-11-9-18(10-12-19)23(31)28-24(32)27-21-15-13-20(14-16-21)26-22(30)8-6-7-17-29(4)5/h9-16H,6-8,17H2,1-5H3,(H,26,30)(H2,27,28,31,32) |
| InChIKey | BVJSXSQRIUSRCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Sir2 inhibitor An EC 3.5.1.98 (histone deacetylase) inhibitor that interferes with the action of Sir2. p53 activator Any activator of tumour protein p53. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenovin-6 (CHEBI:77729) has role antineoplastic agent (CHEBI:35610) |
| tenovin-6 (CHEBI:77729) has role p53 activator (CHEBI:77731) |
| tenovin-6 (CHEBI:77729) has role Sir2 inhibitor (CHEBI:71181) |
| tenovin-6 (CHEBI:77729) is a monocarboxylic acid amide (CHEBI:29347) |
| tenovin-6 (CHEBI:77729) is a tertiary amino compound (CHEBI:50996) |
| tenovin-6 (CHEBI:77729) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| 4-tert-butyl-N-[(4-{[5-(dimethylamino)pentanoyl]amino}phenyl)carbamothioyl]benzamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13113367 | Reaxys |
| Citations |
|---|