EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H5O4 |
| Net Charge | -1 |
| Average Mass | 201.157 |
| Monoisotopic Mass | 201.01933 |
| SMILES | O=c1ccc2c([O-])c3ccoc3cc2o1 |
| InChI | InChI=1S/C11H6O4/c12-10-2-1-6-9(15-10)5-8-7(11(6)13)3-4-14-8/h1-5,13H/p-1 |
| InChIKey | GIJHDGJRTUSBJR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bergaptol(1−) (CHEBI:77728) is a phenolate anion (CHEBI:50525) |
| bergaptol(1−) (CHEBI:77728) is conjugate base of bergaptol (CHEBI:17377) |
| Incoming Relation(s) |
| bergaptol (CHEBI:17377) is conjugate acid of bergaptol(1−) (CHEBI:77728) |
| IUPAC Name |
|---|
| 7-oxo-7H-furo[3,2-g]chromen-4-olate |
| UniProt Name | Source |
|---|---|
| bergaptol | UniProt |