EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11N3O2 |
| Net Charge | 0 |
| Average Mass | 133.151 |
| Monoisotopic Mass | 133.08513 |
| SMILES | CCN(CC)N(O)N=O |
| InChI | InChI=1S/C4H11N3O2/c1-3-6(4-2)7(9)5-8/h9H,3-4H2,1-2H3 |
| InChIKey | GYEBVHSGJPHJRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-diethyl-2-hydroxy-3-oxotriazane (CHEBI:77714) has role nitric oxide donor (CHEBI:50566) |
| 1,1-diethyl-2-hydroxy-3-oxotriazane (CHEBI:77714) is a nitroso compound (CHEBI:35800) |
| 1,1-diethyl-2-hydroxy-3-oxotriazane (CHEBI:77714) is a tertiary amino compound (CHEBI:50996) |
| 1,1-diethyl-2-hydroxy-3-oxotriazane (CHEBI:77714) is conjugate acid of NONOate(1−) (CHEBI:77713) |
| Incoming Relation(s) |
| NONOate(1−) (CHEBI:77713) is conjugate base of 1,1-diethyl-2-hydroxy-3-oxotriazane (CHEBI:77714) |
| IUPAC Name |
|---|
| 1,1-diethyl-2-hydroxy-3-oxotriazane |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8137588 | Reaxys |