EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H25O10 |
| Net Charge | -1 |
| Average Mass | 545.520 |
| Monoisotopic Mass | 545.14532 |
| SMILES | [H][C@]12O[C@@]3(O)CC(=O)c4c(O)c5c6c7c8c9c(c([O-])c(c1c9c3c47)[C@@H](C)O[C@@H]2C)C(=O)C[C@]8(O)O[C@]6([H])[C@@H](C)O[C@@H]5C |
| InChI | InChI=1S/C30H26O10/c1-7-13-21-19-17-15(25(13)33)11(31)5-30(36)24(17)20-18-16(26(34)14-8(2)38-10(4)28(40-30)22(14)20)12(32)6-29(35,23(18)19)39-27(21)9(3)37-7/h7-10,27-28,33-36H,5-6H2,1-4H3/p-1/t7-,8-,9-,10-,27-,28-,29+,30+/m1/s1 |
| InChIKey | HNUPXDLGAHSVEQ-YSPTYUJLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthoaphin(1−) (CHEBI:77712) is a phenolate anion (CHEBI:50525) |
| xanthoaphin(1−) (CHEBI:77712) is conjugate base of xanthoaphin (CHEBI:18073) |
| Incoming Relation(s) |
| xanthoaphin (CHEBI:18073) is conjugate acid of xanthoaphin(1−) (CHEBI:77712) |
| IUPAC Name |
|---|
| (1R,3R,3aS,4aS,8R,10R,10aS,11aS)-4a,11a,14-trihydroxy-1,3,8,10-tetramethyl-6,13-dioxo-3,3a,5,6,8,10,10a,11a,12,13-decahydro-1H,4aH-2,4,9,11-tetraoxadibenzo[bc,kl]coronen-7-olate |
| UniProt Name | Source |
|---|---|
| xanthoaphin | UniProt |