EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11N.C4H11N3O2 |
| Net Charge | 0 |
| Average Mass | 206.290 |
| Monoisotopic Mass | 206.17428 |
| SMILES | CCN(CC)N(O)N=O.CCNCC |
| InChI | InChI=1S/C4H11N3O2.C4H11N/c1-3-6(4-2)7(9)5-8;1-3-5-4-2/h9H,3-4H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | LBJLVZKEUWCGIA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylamine NONOate (CHEBI:77707) has part NONOate(1−) (CHEBI:77713) |
| diethylamine NONOate (CHEBI:77707) has role nitric oxide donor (CHEBI:50566) |
| diethylamine NONOate (CHEBI:77707) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 1,1-diethyl-2-hydroxy-3-oxotriazane—N-ethylethanamine (1/1) |
| N-ethylethanaminium 1,1-diethyl-3-oxotriazan-2-olate |
| Synonyms | Source |
|---|---|
| DEA/NO | ChEBI |
| DEA NONOate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8435159 | Reaxys |
| Citations |
|---|