EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH3NO2 |
| Net Charge | 0 |
| Average Mass | 61.040 |
| Monoisotopic Mass | 61.01638 |
| SMILES | C[N+](=O)[O-] |
| InChI | InChI=1S/CH3NO2/c1-2(3)4/h1H3 |
| InChIKey | LYGJENNIWJXYER-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Role: | EC 4.3.1.3 (histidine ammonia-lyase) inhibitor An EC 4.3.1.* (ammonia-lyase) inhibitor that interferes with the action of histidine ammonia-lyase (EC 4.3.1.3). |
| Applications: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitromethane (CHEBI:77701) has role EC 4.3.1.3 (histidine ammonia-lyase) inhibitor (CHEBI:77703) |
| nitromethane (CHEBI:77701) has role explosive (CHEBI:63490) |
| nitromethane (CHEBI:77701) has role NMR chemical shift reference compound (CHEBI:228364) |
| nitromethane (CHEBI:77701) has role polar aprotic solvent (CHEBI:48358) |
| nitromethane (CHEBI:77701) is a primary nitroalkane (CHEBI:133972) |
| nitromethane (CHEBI:77701) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| nitromethane |
| Synonyms | Source |
|---|---|
| CH3NO2 | ChEBI |
| MeNO2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19275 | KEGG COMPOUND |
| CPD-8133 | MetaCyc |
| Nitromethane | Wikipedia |
| Citations |
|---|