EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O2 |
| Net Charge | 0 |
| Average Mass | 74.079 |
| Monoisotopic Mass | 74.03678 |
| SMILES | COC(C)=O |
| InChI | InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 |
| InChIKey | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Biological Role: | EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor An EC 3.4.19.* (omega-peptidase) inhibitor that interferes with the action of pyroglutamyl-peptidase I (EC 3.4.19.3). |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl acetate (CHEBI:77700) has role EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor (CHEBI:77706) |
| methyl acetate (CHEBI:77700) has role fragrance (CHEBI:48318) |
| methyl acetate (CHEBI:77700) has role polar aprotic solvent (CHEBI:48358) |
| methyl acetate (CHEBI:77700) is a acetate ester (CHEBI:47622) |
| methyl acetate (CHEBI:77700) is a methyl ester (CHEBI:25248) |
| methyl acetate (CHEBI:77700) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| methyl acetate |
| Synonyms | Source |
|---|---|
| acetic acid methyl ester | ChemIDplus |
| CH3COOCH3 | ChEBI |
| AcOMe | ChEBI |
| CH3CO2CH3 | ChEBI |
| MeOAc | ChEBI |
| methyl ethanoate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| methyl acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Methyl_acetate | Wikipedia |
| HMDB0031523 | HMDB |
| METHYL-ACETATE | MetaCyc |
| C17530 | KEGG COMPOUND |
| Citations |
|---|