EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3ClN6 |
| Net Charge | 0 |
| Average Mass | 206.596 |
| Monoisotopic Mass | 206.01077 |
| SMILES | Clc1ccc2c(c1)nnc1nnnn12 |
| InChI | InChI=1S/C7H3ClN6/c8-4-1-2-6-5(3-4)9-10-7-11-12-13-14(6)7/h1-3H |
| InChIKey | MFYMBIZGFDNLPT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CTBT (CHEBI:77693) has role antifungal agent (CHEBI:35718) |
| CTBT (CHEBI:77693) is a organic heterotricyclic compound (CHEBI:26979) |
| CTBT (CHEBI:77693) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 7-chlorotetrazolo[5,1-c][1,2,4]benzotriazine |
| Synonym | Source |
|---|---|
| 7-chlorotetrazolo[5,1-c]benzo[1.2.4]triazine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP1502918 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12163903 | Reaxys |
| Citations |
|---|