EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O11 |
| Net Charge | 0 |
| Average Mass | 548.670 |
| Monoisotopic Mass | 548.31966 |
| SMILES | CC[C@@H](/C=C(/C)[C@H]1C[C@H](OC)C[C@@H](O)C(C)(C)[C@]2(O)O[C@H](C[C@H](OC)[C@@H](O)C(=O)O1)C[C@H](OC)[C@@H]2O)CO |
| InChI | InChI=1S/C27H48O11/c1-8-16(14-28)9-15(2)19-10-17(34-5)13-22(29)26(3,4)27(33)24(31)21(36-7)12-18(38-27)11-20(35-6)23(30)25(32)37-19/h9,16-24,28-31,33H,8,10-14H2,1-7H3/b15-9-/t16-,17-,18+,19+,20-,21-,22+,23+,24-,27+/m0/s1 |
| InChIKey | NETARJWZTMGMRM-JRTPPQMASA-N |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peloruside A (CHEBI:77692) has role antimitotic (CHEBI:64911) |
| peloruside A (CHEBI:77692) has role antineoplastic agent (CHEBI:35610) |
| peloruside A (CHEBI:77692) has role marine metabolite (CHEBI:76507) |
| peloruside A (CHEBI:77692) has role microtubule-stabilising agent (CHEBI:61950) |
| peloruside A (CHEBI:77692) is a cyclic hemiketal (CHEBI:59780) |
| peloruside A (CHEBI:77692) is a ether (CHEBI:25698) |
| peloruside A (CHEBI:77692) is a macrolide (CHEBI:25106) |
| peloruside A (CHEBI:77692) is a organic heterobicyclic compound (CHEBI:27171) |
| peloruside A (CHEBI:77692) is a primary alcohol (CHEBI:15734) |
| peloruside A (CHEBI:77692) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3S,4R,7R,9R,11R,13S,14S,15S)-4,11,13,14-tetrahydroxy-7-[(2Z,4S)-4-(hydroxymethyl)hex-2-en-2-yl]-3,9,15-trimethoxy-12,12-dimethyl-6,17-dioxabicyclo[11.3.1]heptadecan-5-one |
| Synonym | Source |
|---|---|
| (−)-peloruside A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14282578 | Reaxys |
| Citations |
|---|