EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N5O3 |
| Net Charge | +1 |
| Average Mass | 278.292 |
| Monoisotopic Mass | 278.12477 |
| SMILES | Nc1nc(=O)c2c(C[NH2+][C@H]3C=C[C@H](O)[C@@H]3O)cnc2n1 |
| InChI | InChI=1S/C12H15N5O3/c13-12-16-10-8(11(20)17-12)5(4-15-10)3-14-6-1-2-7(18)9(6)19/h1-2,4,6-7,9,14,18-19H,3H2,(H4,13,15,16,17,20)/p+1/t6-,7-,9+/m0/s1 |
| InChIKey | WYROLENTHWJFLR-ACLDMZEESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| queuine(1+) (CHEBI:77674) is a ammonium ion derivative (CHEBI:35274) |
| queuine(1+) (CHEBI:77674) is a organic cation (CHEBI:25697) |
| queuine(1+) (CHEBI:77674) is conjugate acid of queuine (CHEBI:17433) |
| Incoming Relation(s) |
| queuine (CHEBI:17433) is conjugate base of queuine(1+) (CHEBI:77674) |
| IUPAC Name |
|---|
| (1S,4S,5R)-N-[(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]-4,5-dihydroxycyclopent-2-en-1-aminium |