EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N4O9 |
| Net Charge | -2 |
| Average Mass | 498.448 |
| Monoisotopic Mass | 498.13978 |
| SMILES | [NH3+][C@H](CCOc1ccc(/C(=N/[O-])C(=O)N[C@H]2CN([C@@H](C(=O)[O-])c3ccc(O)cc3)C2=O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C23H24N4O9/c24-16(22(31)32)9-10-36-15-7-3-12(4-8-15)18(26-35)20(29)25-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-17,19,28,35H,9-11,24H2,(H,25,29)(H,31,32)(H,33,34)/p-2/b26-18-/t16-,17+,19-/m1/s1 |
| InChIKey | CTNZOGJNVIFEBA-UPSUJEDGSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin A(2−) (CHEBI:77658) is a dicarboxylic acid dianion (CHEBI:28965) |
| nocardicin A(2−) (CHEBI:77658) is conjugate base of nocardicin A (CHEBI:17711) |
| nocardicin A(2−) (CHEBI:77658) is conjugate base of nocardicin A(1−) (CHEBI:58244) |
| Incoming Relation(s) |
| nocardicin A (CHEBI:17711) is conjugate acid of nocardicin A(2−) (CHEBI:77658) |
| nocardicin A(1−) (CHEBI:58244) is conjugate acid of nocardicin A(2−) (CHEBI:77658) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-4-{4-[(1Z)-2-({(3S)-1-[(R)-carboxylato(4-hydroxyphenyl)methyl]-2-oxoazetidin-3-yl}amino)-N-oxido-2-oxoethanimidoyl]phenoxy}butanoate |
| UniProt Name | Source |
|---|---|
| nocardicin A | UniProt |