EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H43NO8 |
| Net Charge | 0 |
| Average Mass | 485.618 |
| Monoisotopic Mass | 485.29887 |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](O)[C@H](O[C@H]2[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@](C)(O)[C@@H]([C@@H](C)O)OC(=O)[C@@H]2C)O1 |
| InChI | InChI=1S/C25H43NO8/c1-13-11-14(2)21(33-24-20(29)18(26(7)8)12-15(3)32-24)16(4)23(30)34-22(17(5)27)25(6,31)10-9-19(13)28/h9-10,13-18,20-22,24,27,29,31H,11-12H2,1-8H3/b10-9+/t13-,14+,15-,16-,17-,18+,20-,21+,22-,24+,25+/m1/s1 |
| InChIKey | HYJMTIGQCJGKFQ-CGNAQTDSSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| novamethymycin (CHEBI:77652) has role bacterial metabolite (CHEBI:76969) |
| novamethymycin (CHEBI:77652) is a enone (CHEBI:51689) |
| novamethymycin (CHEBI:77652) is a macrolide antibiotic (CHEBI:25105) |
| novamethymycin (CHEBI:77652) is a monosaccharide derivative (CHEBI:63367) |
| novamethymycin (CHEBI:77652) is conjugate base of novamethymycin(1+) (CHEBI:77354) |
| Incoming Relation(s) |
| novamethymycin(1+) (CHEBI:77354) is conjugate acid of novamethymycin (CHEBI:77652) |
| IUPAC Name |
|---|
| (3R,4S,5S,7R,9E,11R,12S)-11-hydroxy-12-[(1R)-1-hydroxyethyl]-3,5,7,11-tetramethyl-2,8-dioxooxacyclododec-9-en-4-yl 3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside |
| Manual Xrefs | Databases |
|---|---|
| CPD-15998 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8953976 | Reaxys |
| Citations |
|---|