EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H87N5O7 |
| Net Charge | 0 |
| Average Mass | 918.318 |
| Monoisotopic Mass | 917.66055 |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)OC)C(C)CC)C(C)C |
| InChI | InChI=1S/C54H87N5O7/c1-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-32-37-47(60)56-46(39-44-35-30-27-31-36-44)53(64)59(7)49(40(3)4)52(63)58-48(41(5)10-2)51(62)57-45(38-43-33-28-26-29-34-43)50(61)55-42(6)54(65)66-8/h26-31,33-36,40-42,45-46,48-49H,9-25,32,37-39H2,1-8H3,(H,55,61)(H,56,60)(H,57,62)(H,58,63)/t41?,42-,45-,46+,48-,49-/m0/s1 |
| InChIKey | QELDWYWOKVBKFM-YOFCLZFBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Para-LP-01 (CHEBI:77637) has role antigen (CHEBI:59132) |
| Para-LP-01 (CHEBI:77637) is a lipopeptide (CHEBI:46895) |
| Para-LP-01 (CHEBI:77637) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl N-icosanoyl-D-phenylalanyl-N-methyl-L-valyl-L-isoleucyl-L-phenylalanyl-L-alaninate |
| Synonym | Source |
|---|---|
| C20 fatty acyl-D-Phe-N-Me-L-Val-L-Ile-L-Phe-L-Ala methyl ester | ChEBI |
| Citations |
|---|