EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N.HCl |
| Net Charge | 0 |
| Average Mass | 327.899 |
| Monoisotopic Mass | 327.17538 |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/b9-5+; |
| InChIKey | BWMISRWJRUSYEX-SZKNIZGXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbinafine hydrochloride (CHEBI:77614) has part terbinafine(1+) (CHEBI:77615) |
| terbinafine hydrochloride (CHEBI:77614) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| terbinafine hydrochloride (CHEBI:77614) has role P450 inhibitor (CHEBI:50183) |
| terbinafine hydrochloride (CHEBI:77614) is a allylamine antifungal drug (CHEBI:87127) |
| terbinafine hydrochloride (CHEBI:77614) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine hydrochloride |
| (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-aminium chloride |
| Synonyms | Source |
|---|---|
| (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine hydrochloride | ChemIDplus |
| Terbinafine HCl | ChemIDplus |
| terbinafine monohydrochloride | ChEBI |
| Brand Name | Source |
|---|---|
| Lamisil | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02219 | KEGG DRUG |
| DB00857 | DrugBank |
| Terbinafine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5660449 | Reaxys |
| CAS:78628-80-5 | KEGG DRUG |
| CAS:78628-80-5 | ChemIDplus |
| Citations |
|---|