EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6NO5 |
| Net Charge | -1 |
| Average Mass | 184.127 |
| Monoisotopic Mass | 184.02515 |
| SMILES | [NH3+]/C(C(=O)[O-])=C(/C=C\C=O)C(=O)[O-] |
| InChI | InChI=1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13)/p-1/b2-1-,5-4- |
| InChIKey | KACPVQQHDVBVFC-OIFXTYEKSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis,cis-2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77612) has role human metabolite (CHEBI:77746) |
| cis,cis-2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77612) is a dicarboxylic acid anion (CHEBI:35693) |
| cis,cis-2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77612) is a α-amino-acid anion (CHEBI:33558) |
| cis,cis-2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77612) is conjugate acid of cis,cis-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:994) |
| Incoming Relation(s) |
| cis,cis-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:994) is conjugate base of cis,cis-2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77612) |
| IUPAC Name |
|---|
| (2Z)-2-azaniumyl-3-[(1Z)-3-oxoprop-1-en-1-yl]but-2-enedioate |
| Synonym | Source |
|---|---|
| (2Z)-2-ammonio-3-[(1Z)-3-oxoprop-1-en-1-yl]but-2-enedioate | IUPAC |
| UniProt Name | Source |
|---|---|
| (2Z,4Z)-2-amino-3-carboxymuconate 6-semialdehyde | UniProt |