EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15F3N4O3 |
| Net Charge | 0 |
| Average Mass | 404.348 |
| Monoisotopic Mass | 404.10962 |
| SMILES | N[C@H]1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C19H15F3N4O3/c20-9-1-2-15(13(21)5-9)26-8-12(19(28)29)16(27)11-6-14(22)18(24-17(11)26)25-4-3-10(23)7-25/h1-2,5-6,8,10H,3-4,7,23H2,(H,28,29)/t10-/m0/s1 |
| InChIKey | WUWFMDMBOJLQIV-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-tosufloxacin (CHEBI:77582) is a 7-(3-aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid (CHEBI:77581) |
| (S)-tosufloxacin (CHEBI:77582) is conjugate base of (S)-tosufloxacin(1+) (CHEBI:77594) |
| (S)-tosufloxacin (CHEBI:77582) is enantiomer of (R)-tosufloxacin (CHEBI:77584) |
| Incoming Relation(s) |
| tosufloxacin (CHEBI:77573) has part (S)-tosufloxacin (CHEBI:77582) |
| (S)-tosufloxacin(1+) (CHEBI:77594) is conjugate acid of (S)-tosufloxacin (CHEBI:77582) |
| (R)-tosufloxacin (CHEBI:77584) is enantiomer of (S)-tosufloxacin (CHEBI:77582) |
| IUPAC Name |
|---|
| 7-[(3S)-3-aminopyrrolidin-1-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4913118 | Reaxys |