EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77572 - tranilast
| Formula | C18H17NO5 |
| Net Charge | 0 |
| Average Mass | 327.336 |
| Monoisotopic Mass | 327.11067 |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22/h3-11H,1-2H3,(H,19,20)(H,21,22)/b10-8+ |
| InChIKey | NZHGWWWHIYHZNX-CSKARUKUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-asthmatic drug A drug used to treat asthma. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tranilast (CHEBI:77572) has functional parent anthranilic acid (CHEBI:30754) |
| tranilast (CHEBI:77572) has role anti-allergic agent (CHEBI:50857) |
| tranilast (CHEBI:77572) has role anti-asthmatic drug (CHEBI:49167) |
| tranilast (CHEBI:77572) has role antineoplastic agent (CHEBI:35610) |
| tranilast (CHEBI:77572) has role antirheumatic drug (CHEBI:35842) |
| tranilast (CHEBI:77572) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| tranilast (CHEBI:77572) has role calcium channel blocker (CHEBI:38215) |
| tranilast (CHEBI:77572) has role hepatoprotective agent (CHEBI:62868) |
| tranilast (CHEBI:77572) has role nephroprotective agent (CHEBI:76595) |
| tranilast (CHEBI:77572) is a amidobenzoic acid (CHEBI:48470) |
| tranilast (CHEBI:77572) is a cinnamamides (CHEBI:23247) |
| tranilast (CHEBI:77572) is a dimethoxybenzene (CHEBI:51681) |
| tranilast (CHEBI:77572) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-{[(2E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino}benzoic acid |
| INNs | Source |
|---|---|
| tranilast | WHO MedNet |
| tranilast | WHO MedNet |
| tranilast | KEGG DRUG |
| tranilastum | ChemIDplus |
| Synonyms | Source |
|---|---|
| MK 341 | ChemIDplus |
| MK-341 | ChemIDplus |
| N-(3,4-Dimethoxycinnamoyl)anthranilic acid | ChemIDplus |
| NSC-758970 | ChEMBL |
| Brand Name | Source |
|---|---|
| Rizaben | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3085768 | Reaxys |
| CAS:53902-12-8 | KEGG DRUG |
| CAS:53902-12-8 | ChemIDplus |
| Citations |
|---|