EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO5 |
| Net Charge | 0 |
| Average Mass | 327.336 |
| Monoisotopic Mass | 327.11067 |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22/h3-11H,1-2H3,(H,19,20)(H,21,22)/b10-8+ |
| InChIKey | NZHGWWWHIYHZNX-CSKARUKUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-asthmatic drug A drug used to treat asthma. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tranilast (CHEBI:77572) has functional parent anthranilic acid (CHEBI:30754) |
| tranilast (CHEBI:77572) has role anti-allergic agent (CHEBI:50857) |
| tranilast (CHEBI:77572) has role anti-asthmatic drug (CHEBI:49167) |
| tranilast (CHEBI:77572) has role antineoplastic agent (CHEBI:35610) |
| tranilast (CHEBI:77572) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| tranilast (CHEBI:77572) has role calcium channel blocker (CHEBI:38215) |
| tranilast (CHEBI:77572) has role hepatoprotective agent (CHEBI:62868) |
| tranilast (CHEBI:77572) has role nephroprotective agent (CHEBI:76595) |
| tranilast (CHEBI:77572) is a amidobenzoic acid (CHEBI:48470) |
| tranilast (CHEBI:77572) is a cinnamamides (CHEBI:23247) |
| tranilast (CHEBI:77572) is a dimethoxybenzene (CHEBI:51681) |
| tranilast (CHEBI:77572) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-{[(2E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino}benzoic acid |
| INNs | Source |
|---|---|
| tranilast | KEGG DRUG |
| tranilastum | ChemIDplus |
| tranilast | WHO MedNet |
| tranilast | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-(3,4-Dimethoxycinnamoyl)anthranilic acid | ChemIDplus |
| MK 341 | ChemIDplus |
| MK-341 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Rizaben | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3085768 | Reaxys |
| CAS:53902-12-8 | KEGG DRUG |
| CAS:53902-12-8 | ChemIDplus |
| Citations |
|---|