EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F3N4O3.CH4O3S |
| Net Charge | 0 |
| Average Mass | 512.466 |
| Monoisotopic Mass | 512.09774 |
| SMILES | CS(=O)(=O)O.[H][C@@]12CN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(F)cc3F)C[C@]1([H])[C@H]2N |
| InChI | InChI=1S/C20H15F3N4O3.CH4O3S/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24;1-5(2,3)4/h1-4,7,10-11,16H,5-6,24H2,(H,29,30);1H3,(H,2,3,4)/t10-,11+,16+; |
| InChIKey | DYNZICQDCVYXFW-AHZSKCOESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trovafloxacin mesylate (CHEBI:77568) has part trovafloxacin(1+) (CHEBI:77569) |
| trovafloxacin mesylate (CHEBI:77568) has role antibacterial drug (CHEBI:36047) |
| trovafloxacin mesylate (CHEBI:77568) has role antimicrobial agent (CHEBI:33281) |
| trovafloxacin mesylate (CHEBI:77568) has role DNA synthesis inhibitor (CHEBI:59517) |
| trovafloxacin mesylate (CHEBI:77568) has role hepatotoxic agent (CHEBI:50908) |
| trovafloxacin mesylate (CHEBI:77568) has role topoisomerase IV inhibitor (CHEBI:53559) |
| trovafloxacin mesylate (CHEBI:77568) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Names |
|---|
| (1R,5S,6s)-3-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]-3-azabicyclo[3.1.0]hexan-6-aminium methanesulfonate |
| 7-[(1R,5S,6s)-6-amino-3-azabicyclo[3.1.0]hex-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid methanesulfonate |
| Synonyms | Source |
|---|---|
| trovafloxacin methanesulfonate | ChEBI |
| trovafloxacin monomesylate | ChEBI |
| Trovafloxacin monomethanesulfonate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Trovan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02123 | KEGG DRUG |
| DB00685 | DrugBank |
| EP0930068 | Patent |
| NZ553119 | Patent |
| Trovafloxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8180672 | Reaxys |
| CAS:147059-75-4 | ChemIDplus |
| Citations |
|---|