EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F3N4O3.CH4O3S |
| Net Charge | 0 |
| Average Mass | 512.466 |
| Monoisotopic Mass | 512.09774 |
| SMILES | CS(=O)(=O)O.[H][C@@]12CN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(F)cc3F)C[C@]1([H])[C@H]2N |
| InChI | InChI=1S/C20H15F3N4O3.CH4O3S/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24;1-5(2,3)4/h1-4,7,10-11,16H,5-6,24H2,(H,29,30);1H3,(H,2,3,4)/t10-,11+,16+; |
| InChIKey | DYNZICQDCVYXFW-AHZSKCOESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trovafloxacin mesylate (CHEBI:77568) has part trovafloxacin(1+) (CHEBI:77569) |
| trovafloxacin mesylate (CHEBI:77568) has role antibacterial drug (CHEBI:36047) |
| trovafloxacin mesylate (CHEBI:77568) has role antimicrobial agent (CHEBI:33281) |
| trovafloxacin mesylate (CHEBI:77568) has role DNA synthesis inhibitor (CHEBI:59517) |
| trovafloxacin mesylate (CHEBI:77568) has role hepatotoxic agent (CHEBI:50908) |
| trovafloxacin mesylate (CHEBI:77568) has role topoisomerase IV inhibitor (CHEBI:53559) |
| trovafloxacin mesylate (CHEBI:77568) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Names |
|---|
| (1R,5S,6s)-3-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]-3-azabicyclo[3.1.0]hexan-6-aminium methanesulfonate |
| 7-[(1R,5S,6s)-6-amino-3-azabicyclo[3.1.0]hex-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid methanesulfonate |
| Synonyms | Source |
|---|---|
| CP-99,219-27 | ChEMBL |
| CP-99219-27 | ChEMBL |
| trovafloxacin methanesulfonate | ChEBI |
| trovafloxacin monomesylate | ChEBI |
| Trovafloxacin monomethanesulfonate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Trovan | KEGG DRUG |
| Trovan mesylate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D02123 | KEGG DRUG |
| DB00685 | DrugBank |
| EP0930068 | Patent |
| NZ553119 | Patent |
| Trovafloxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8180672 | Reaxys |
| CAS:147059-75-4 | ChemIDplus |
| Citations |
|---|