EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H4Br4O2 |
| Net Charge | 0 |
| Average Mass | 499.778 |
| Monoisotopic Mass | 495.69448 |
| SMILES | Brc1cc2c(cc1Br)Oc1cc(Br)c(Br)cc1O2 |
| InChI | InChI=1S/C12H4Br4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H |
| InChIKey | JZLQUWSWOJPCAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,7,8-tetrabromodibenzodioxine (CHEBI:77565) is a dibenzodioxine (CHEBI:23825) |
| 2,3,7,8-tetrabromodibenzodioxine (CHEBI:77565) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 2,3,7,8-tetrabromooxanthrene |
| Synonyms | Source |
|---|---|
| 2,3,7,8-Tetrabromodibenzodioxin | ChemIDplus |
| 2,3,7,8-Tetrabromodibenzo-4-dioxin | ChemIDplus |
| 2,3,7,8-Tetrabromodibenzo-p-dioxin | ChemIDplus |
| 2,3,7,8-TBDD | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:273317 | Reaxys |
| CAS:50585-41-6 | ChemIDplus |
| Citations |
|---|