EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N4O3 |
| Net Charge | 0 |
| Average Mass | 316.361 |
| Monoisotopic Mass | 316.15354 |
| SMILES | COc1ccc2nc3nnc(C)c3c(NCCOCCO)c2c1 |
| InChI | InChI=1S/C16H20N4O3/c1-10-14-15(17-5-7-23-8-6-21)12-9-11(22-2)3-4-13(12)18-16(14)20-19-10/h3-4,9,21H,5-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | YWEGXZZAORIRQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SCH51344 (CHEBI:77556) has role antineoplastic agent (CHEBI:35610) |
| SCH51344 (CHEBI:77556) is a aromatic amine (CHEBI:33860) |
| SCH51344 (CHEBI:77556) is a aromatic ether (CHEBI:35618) |
| SCH51344 (CHEBI:77556) is a primary alcohol (CHEBI:15734) |
| SCH51344 (CHEBI:77556) is a pyrazoloquinoline (CHEBI:74147) |
| SCH51344 (CHEBI:77556) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-{2-[(6-methoxy-3-methyl-1H-pyrazolo[3,4-b]quinolin-4-yl)amino]ethoxy}ethanol |
| Registry Numbers | Sources |
|---|---|
| CAS:171927-40-5 | SUBMITTER |
| Citations |
|---|