EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O2 |
| Net Charge | 0 |
| Average Mass | 252.398 |
| Monoisotopic Mass | 252.20893 |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h4-5,7-8H,2-3,6,9-15H2,1H3,(H,17,18)/b5-4-,8-7- |
| InChIKey | RVEKLXYYCHAMDF-UTOQUPLUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) has role plant metabolite (CHEBI:76924) |
| (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) is a hexadecadienoic acid (CHEBI:77524) |
| (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) is conjugate acid of (9Z,12Z)-hexadecadienoate (CHEBI:77219) |
| Incoming Relation(s) |
| (9Z,12Z)-hexadecadienoyl-CoA (CHEBI:76889) has functional parent (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) |
| 1-[(10Z,13Z,16Z)-docosatrienoyl]-2-[(9Z,12Z)-hexadecadienoyl]-sn-glycero-3-phospho-1D-myo-inositol (CHEBI:89247) has functional parent (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) |
| (9Z,12Z)-hexadecadienoate (CHEBI:77219) is conjugate base of (9Z,12Z)-hexadecadienoic acid (CHEBI:77522) |
| IUPAC Name |
|---|
| (9Z,12Z)-hexadeca-9,12-dienoic acid |
| Synonyms | Source |
|---|---|
| Palmitolinoleic acid | LIPID MAPS |
| C16:2n-4,7 | LIPID MAPS |
| 9Z,12Z-hexadecadienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030275 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:5070-03-1 | Reaxys |
| Citations |
|---|